About (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone
(4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone (PubChem CID 113269109) has the molecular formula C12H19N3OS
and a molecular weight of 253.37 g/mol. Its IUPAC name is (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 113269109 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CCC(N)CC2C)s1 |
| InChI | InChI=1S/C12H19N3OS/c1-7-6-10(13)4-5-15(7)12(16)11-8(2)14-9(3)17-11/h7,10H,4-6,13H2,1-3H3 |
| InChIKey | BORZSCAVSVCFTF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone?
The IUPAC name of (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone (CID 113269109) is (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone is Cc1nc(C)c(C(=O)N2CCC(N)CC2C)s1.
What is the InChIKey of (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone?
The InChIKey is BORZSCAVSVCFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3OS/c1-7-6-10(13)4-5-15(7)12(16)11-8(2)14-9(3)17-11/h7,10H,4-6,13H2,1-3H3.
What are the key properties of (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone?
(4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone has a molecular weight of 253.37 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-methylpiperidin-1-yl)-(2,4-dimethyl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 113269109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).