About 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide
3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide (PubChem CID 113269527) has the molecular formula C12H18N4S
and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide |
| PubChem CID | 113269527 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide |
| SMILES | CN1CCCN(c2cnccc2C(N)=S)CC1 |
| InChI | InChI=1S/C12H18N4S/c1-15-5-2-6-16(8-7-15)11-9-14-4-3-10(11)12(13)17/h3-4,9H,2,5-8H2,1H3,(H2,13,17) |
| InChIKey | BXRFFXMGKMKTQC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide?
The IUPAC name of 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide (CID 113269527) is 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide.
What is the SMILES notation for 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide?
The canonical SMILES for 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide is CN1CCCN(c2cnccc2C(N)=S)CC1.
What is the InChIKey of 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide?
The InChIKey is BXRFFXMGKMKTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4S/c1-15-5-2-6-16(8-7-15)11-9-14-4-3-10(11)12(13)17/h3-4,9H,2,5-8H2,1H3,(H2,13,17).
What are the key properties of 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide?
3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide has a molecular weight of 250.37 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,4-diazepan-1-yl)pyridine-4-carbothioamide is sourced from PubChem (CID 113269527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).