About [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane
[4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane (PubChem CID 11327251) has the molecular formula C16H27BrO5Si
and a molecular weight of 407.38 g/mol. Its IUPAC name is [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 11327251 |
| Molecular Formula | C16H27BrO5Si |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane |
| SMILES | COCOc1cc(O[Si](C)(C)C(C)(C)C)cc(OCOC)c1Br |
| InChI | InChI=1S/C16H27BrO5Si/c1-16(2,3)23(6,7)22-12-8-13(20-10-18-4)15(17)14(9-12)21-11-19-5/h8-9H,10-11H2,1-7H3 |
| InChIKey | VEIUASVFEBDSFW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane (CID 11327251) is [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane is COCOc1cc(O[Si](C)(C)C(C)(C)C)cc(OCOC)c1Br.
What is the InChIKey of [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane?
The InChIKey is VEIUASVFEBDSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27BrO5Si/c1-16(2,3)23(6,7)22-12-8-13(20-10-18-4)15(17)14(9-12)21-11-19-5/h8-9H,10-11H2,1-7H3.
What are the key properties of [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane?
[4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane has a molecular weight of 407.38 g/mol, XLogP of 4.80, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-3,5-bis(methoxymethoxy)phenoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 11327251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).