C20H19N5O5 — CID 11327309
(2R,3R,4S,5R)-2-[6-anilino-8-(furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11327309) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-anilino-8-(furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-anilino-8-(furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11327309 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-anilino-8-(furan-2-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2c(-c3ccco3)nc3c(Nc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H19N5O5/c26-9-13-15(27)16(28)20(30-13)25-18(12-7-4-8-29-12)24-14-17(21-10-22-19(14)25)23-11-5-2-1-3-6-11/h1-8,10,13,15-16,20,26-28H,9H2,(H,21,22,23)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | LDXFVXJMYJLLMP-KHTYJDQRSA-N |
| XLogP | 1.44 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |