C14H18ClNO3 — CID 113273573
N-(5-chloropentan-2-yl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 113273573) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is N-(5-chloropentan-2-yl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(5-chloropentan-2-yl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 113273573 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(5-chloropentan-2-yl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | CC(CCCCl)NC(=O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C14H18ClNO3/c1-10(4-3-7-15)16-14(17)11-5-2-6-12-13(11)19-9-8-18-12/h2,5-6,10H,3-4,7-9H2,1H3,(H,16,17) |
| InChIKey | STQUOCAQJYSALI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|