C14H14BrNO2S — CID 113274725
N-(2-bromo-1-phenylethyl)-4-methoxythiophene-2-carboxamide (PubChem CID 113274725) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)-4-methoxythiophene-2-carboxamide.
| Compound Name | N-(2-bromo-1-phenylethyl)-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 113274725 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)NC(CBr)c2ccccc2)c1 |
| InChI | InChI=1S/C14H14BrNO2S/c1-18-11-7-13(19-9-11)14(17)16-12(8-15)10-5-3-2-4-6-10/h2-7,9,12H,8H2,1H3,(H,16,17) |
| InChIKey | IFTRYSJMYQATQA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|