C16H24BrNO — CID 113274924
N-(1-bromo-4-methylpentan-2-yl)-3-(2-methylphenyl)propanamide (PubChem CID 113274924) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(1-bromo-4-methylpentan-2-yl)-3-(2-methylphenyl)propanamide.
| Compound Name | N-(1-bromo-4-methylpentan-2-yl)-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113274924 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(1-bromo-4-methylpentan-2-yl)-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1CCC(=O)NC(CBr)CC(C)C |
| InChI | InChI=1S/C16H24BrNO/c1-12(2)10-15(11-17)18-16(19)9-8-14-7-5-4-6-13(14)3/h4-7,12,15H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | NYKXMXKHQZAZGO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|