C23H30O7 — CID 11327551
[(1S,2S,6S,7S,9R,11S,12R,16S)-4,14-dimethoxy-2,6,13,16-tetramethyl-3,15-dioxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-dien-11-yl] acetate (PubChem CID 11327551) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(1S,2S,6S,7S,9R,11S,12R,16S)-4,14-dimethoxy-2,6,13,16-tetramethyl-3,15-dioxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-dien-11-yl] acetate.
| Compound Name | [(1S,2S,6S,7S,9R,11S,12R,16S)-4,14-dimethoxy-2,6,13,16-tetramethyl-3,15-dioxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-dien-11-yl] acetate |
|---|---|
| PubChem CID | 11327551 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(1S,2S,6S,7S,9R,11S,12R,16S)-4,14-dimethoxy-2,6,13,16-tetramethyl-3,15-dioxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-4,13-dien-11-yl] acetate |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3O[C@@H](OC(C)=O)[C@H]4C(C)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@]43C |
| InChI | InChI=1S/C23H30O7/c1-10-8-14(27-6)20(26)22(4)13(10)9-15-23(5)16(21(30-15)29-12(3)24)11(2)18(28-7)17(25)19(22)23/h8,10,13,15-16,19,21H,9H2,1-7H3/t10-,13+,15-,16-,19-,21-,22+,23+/m1/s1 |
| InChIKey | UEQJICQIGFUHLB-LFGLWFPFSA-N |
| XLogP | 2.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |