C25H42O3Si — CID 11327565
(1R,3S,7S,7aR)-4-methyl-1,7-bis(prop-1-en-2-yl)-3-[tri(propan-2-yl)silyloxymethyl]-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one (PubChem CID 11327565) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (1R,3S,7S,7aR)-4-methyl-1,7-bis(prop-1-en-2-yl)-3-[tri(propan-2-yl)silyloxymethyl]-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one.
| Compound Name | (1R,3S,7S,7aR)-4-methyl-1,7-bis(prop-1-en-2-yl)-3-[tri(propan-2-yl)silyloxymethyl]-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
|---|---|
| PubChem CID | 11327565 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (1R,3S,7S,7aR)-4-methyl-1,7-bis(prop-1-en-2-yl)-3-[tri(propan-2-yl)silyloxymethyl]-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
| SMILES | C=C(C)[C@H]1CC(=O)C(C)=C2[C@@H]1[C@H](C(=C)C)O[C@@H]2CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H42O3Si/c1-14(2)20-12-21(26)19(11)23-22(28-25(15(3)4)24(20)23)13-27-29(16(5)6,17(7)8)18(9)10/h16-18,20,22,24-25H,1,3,12-13H2,2,4-11H3/t20-,22-,24-,25+/m1/s1 |
| InChIKey | VVYXFNYEUGEQBM-ZUUNWQIRSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|