About 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine
6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine (PubChem CID 11327585) has the molecular formula C21H25F2N3O
and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine |
| PubChem CID | 11327585 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine |
| SMILES | Fc1cc(F)cc(Nc2ccc(CNCC3CCOCC3)c(C3CC3)n2)c1 |
| InChI | InChI=1S/C21H25F2N3O/c22-17-9-18(23)11-19(10-17)25-20-4-3-16(21(26-20)15-1-2-15)13-24-12-14-5-7-27-8-6-14/h3-4,9-11,14-15,24H,1-2,5-8,12-13H2,(H,25,26) |
| InChIKey | CGRDZJWIJJTRBE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine?
The IUPAC name of 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine (CID 11327585) is 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine.
What is the SMILES notation for 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine?
The canonical SMILES for 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine is Fc1cc(F)cc(Nc2ccc(CNCC3CCOCC3)c(C3CC3)n2)c1.
What is the InChIKey of 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine?
The InChIKey is CGRDZJWIJJTRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N3O/c22-17-9-18(23)11-19(10-17)25-20-4-3-16(21(26-20)15-1-2-15)13-24-12-14-5-7-27-8-6-14/h3-4,9-11,14-15,24H,1-2,5-8,12-13H2,(H,25,26).
What are the key properties of 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine?
6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine has a molecular weight of 373.45 g/mol, XLogP of 4.50, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-N-(3,5-difluorophenyl)-5-[(oxan-4-ylmethylamino)methyl]pyridin-2-amine is sourced from PubChem (CID 11327585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).