C14H16BrNO3 — CID 113275942
N-(2-bromo-2-cyclopropylethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 113275942) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is N-(2-bromo-2-cyclopropylethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(2-bromo-2-cyclopropylethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 113275942 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2-bromo-2-cyclopropylethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(NCC(Br)C1CC1)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C14H16BrNO3/c15-11(9-4-5-9)8-16-14(17)10-2-1-3-12-13(10)19-7-6-18-12/h1-3,9,11H,4-8H2,(H,16,17) |
| InChIKey | WJXBIQGOYIWWRU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|