C12H12BrFN2O3 — CID 113275950
N-(2-bromo-2-cyclopropylethyl)-2-fluoro-4-nitrobenzamide (PubChem CID 113275950) has the molecular formula C12H12BrFN2O3 and a molecular weight of 331.14 g/mol. Its IUPAC name is N-(2-bromo-2-cyclopropylethyl)-2-fluoro-4-nitrobenzamide.
| Compound Name | N-(2-bromo-2-cyclopropylethyl)-2-fluoro-4-nitrobenzamide |
|---|---|
| PubChem CID | 113275950 |
| Molecular Formula | C12H12BrFN2O3 |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(2-bromo-2-cyclopropylethyl)-2-fluoro-4-nitrobenzamide |
| SMILES | O=C(NCC(Br)C1CC1)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H12BrFN2O3/c13-10(7-1-2-7)6-15-12(17)9-4-3-8(16(18)19)5-11(9)14/h3-5,7,10H,1-2,6H2,(H,15,17) |
| InChIKey | CYVJCALUMFSINS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|