C24H36O6 — CID 11327620
[(1R,3R,6S,8S,10R,11R,12S,15S)-8-acetyloxy-10,11-dihydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate (PubChem CID 11327620) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(1R,3R,6S,8S,10R,11R,12S,15S)-8-acetyloxy-10,11-dihydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate.
| Compound Name | [(1R,3R,6S,8S,10R,11R,12S,15S)-8-acetyloxy-10,11-dihydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
|---|---|
| PubChem CID | 11327620 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(1R,3R,6S,8S,10R,11R,12S,15S)-8-acetyloxy-10,11-dihydroxy-6,12,16-trimethyl-2-methylidene-3-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
| SMILES | C=C1[C@H](OC(C)=O)CC[C@H](C)C[C@H](OC(C)=O)C2=C(C)[C@@H]3[C@H]1CC[C@]3(C)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C24H36O6/c1-12-7-8-18(29-15(4)25)13(2)17-9-10-24(6)21(17)14(3)20(22(27)23(24)28)19(11-12)30-16(5)26/h12,17-19,21-23,27-28H,2,7-11H2,1,3-6H3/t12-,17-,18+,19-,21+,22+,23-,24-/m0/s1 |
| InChIKey | DUKWBKXNUBUWDR-YGWOOMRRSA-N |
| XLogP | 3.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|