About 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide
1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide (PubChem CID 11327629) has the molecular formula C23H21BrN2O
and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide.
Molecular Properties
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide |
| PubChem CID | 11327629 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide |
| SMILES | COc1ccc(CN2CC[n+]3c2c2ccccc2c2ccccc23)cc1.[Br-] |
| InChI | InChI=1S/C23H21N2O.BrH/c1-26-18-12-10-17(11-13-18)16-24-14-15-25-22-9-5-4-7-20(22)19-6-2-3-8-21(19)23(24)25;/h2-13H,14-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | VJMAYVWRDWGONL-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide (CID 11327629) is 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide.
What is the SMILES notation for 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The canonical SMILES for 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide is COc1ccc(CN2CC[n+]3c2c2ccccc2c2ccccc23)cc1.[Br-].
What is the InChIKey of 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The InChIKey is VJMAYVWRDWGONL-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H21N2O.BrH/c1-26-18-12-10-17(11-13-18)16-24-14-15-25-22-9-5-4-7-20(22)19-6-2-3-8-21(19)23(24)25;/h2-13H,14-16H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide has a molecular weight of 421.34 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxyphenyl)methyl]-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide is sourced from PubChem (CID 11327629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).