C14H19BrFNO — CID 113276417
N-(4-bromo-2-ethylbutyl)-2-fluoro-4-methylbenzamide (PubChem CID 113276417) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is N-(4-bromo-2-ethylbutyl)-2-fluoro-4-methylbenzamide.
| Compound Name | N-(4-bromo-2-ethylbutyl)-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 113276417 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-(4-bromo-2-ethylbutyl)-2-fluoro-4-methylbenzamide |
| SMILES | CCC(CCBr)CNC(=O)c1ccc(C)cc1F |
| InChI | InChI=1S/C14H19BrFNO/c1-3-11(6-7-15)9-17-14(18)12-5-4-10(2)8-13(12)16/h4-5,8,11H,3,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | ZYBYFBJSBPFPLG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|