C18H5BF10 — CID 11327649
bis(2,3,4,5,6-pentafluorophenyl)-phenylborane (PubChem CID 11327649) has the molecular formula C18H5BF10 and a molecular weight of 422.03 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-phenylborane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-phenylborane |
|---|---|
| PubChem CID | 11327649 |
| Molecular Formula | C18H5BF10 |
| Molecular Weight | 422.03 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-phenylborane |
| SMILES | Fc1c(F)c(F)c(B(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18H5BF10/c20-9-7(10(21)14(25)17(28)13(9)24)19(6-4-2-1-3-5-6)8-11(22)15(26)18(29)16(27)12(8)23/h1-5H |
| InChIKey | PCGYNXNSBCFBSU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.03 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|