C10H10N4O3S — CID 1132766
2-[1-(3-methoxyphenyl)tetrazol-5-yl]sulfanylacetic acid (PubChem CID 1132766) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-[1-(3-methoxyphenyl)tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(3-methoxyphenyl)tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 1132766 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[1-(3-methoxyphenyl)tetrazol-5-yl]sulfanylacetic acid |
| SMILES | COc1cccc(-n2nnnc2SCC(=O)O)c1 |
| InChI | InChI=1S/C10H10N4O3S/c1-17-8-4-2-3-7(5-8)14-10(11-12-13-14)18-6-9(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | GFADTXVSNAJZGI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |