C21H25N7O3 — CID 11327693
2-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxypropylamino]ethanol (PubChem CID 11327693) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxypropylamino]ethanol.
| Compound Name | 2-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxypropylamino]ethanol |
|---|---|
| PubChem CID | 11327693 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxypropylamino]ethanol |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3ccccc3)ncc(OCCCNCCO)c21 |
| InChI | InChI=1S/C21H25N7O3/c1-2-28-19-15(30-12-6-9-23-10-11-29)13-24-16(14-7-4-3-5-8-14)17(19)25-21(28)18-20(22)27-31-26-18/h3-5,7-8,13,23,29H,2,6,9-12H2,1H3,(H2,22,27) |
| InChIKey | PNLOXGFEAVUBAB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|