C13H13BrClNOS — CID 113276966
2-[[2-(bromomethyl)-3-chlorophenoxy]methyl]-4,5-dimethyl-1,3-thiazole (PubChem CID 113276966) has the molecular formula C13H13BrClNOS and a molecular weight of 346.68 g/mol. Its IUPAC name is 2-[[2-(bromomethyl)-3-chlorophenoxy]methyl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[[2-(bromomethyl)-3-chlorophenoxy]methyl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 113276966 |
| Molecular Formula | C13H13BrClNOS |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 2-[[2-(bromomethyl)-3-chlorophenoxy]methyl]-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(COc2cccc(Cl)c2CBr)sc1C |
| InChI | InChI=1S/C13H13BrClNOS/c1-8-9(2)18-13(16-8)7-17-12-5-3-4-11(15)10(12)6-14/h3-5H,6-7H2,1-2H3 |
| InChIKey | IZFYWELRCOTGIP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|