C22H36N2O6 — CID 11327733
[(5S,6R)-4-(3-hydroxy-6-methylhepta-1,5-dien-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 11327733) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(5S,6R)-4-(3-hydroxy-6-methylhepta-1,5-dien-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | [(5S,6R)-4-(3-hydroxy-6-methylhepta-1,5-dien-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11327733 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [(5S,6R)-4-(3-hydroxy-6-methylhepta-1,5-dien-2-yl)-5-methoxy-1-oxaspiro[2.5]octan-6-yl] N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=C(C(O)CC=C(C)C)C1[C@H](OC)[C@H](OC(=O)N[C@@H](C(N)=O)C(C)C)CCC12CO2 |
| InChI | InChI=1S/C22H36N2O6/c1-12(2)7-8-15(25)14(5)17-19(28-6)16(9-10-22(17)11-29-22)30-21(27)24-18(13(3)4)20(23)26/h7,13,15-19,25H,5,8-11H2,1-4,6H3,(H2,23,26)(H,24,27)/t15?,16-,17?,18-,19-,22?/m1/s1 |
| InChIKey | YDRCIEBZVMQDFT-LHXNUEBSSA-N |
| XLogP | 2.06 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|