C14H19N3O — CID 113278010
4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylpiperazin-2-one (PubChem CID 113278010) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 113278010 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-7-ylmethyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1Cc1cccc2c1NCC2 |
| InChI | InChI=1S/C14H19N3O/c1-10-14(18)16-7-8-17(10)9-12-4-2-3-11-5-6-15-13(11)12/h2-4,10,15H,5-9H2,1H3,(H,16,18) |
| InChIKey | JYBUTOUCVIOUFA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |