C21H25NO7S — CID 11328016
N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-methylbenzenesulfonamide (PubChem CID 11328016) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11328016 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(2R,4aR,6S,7R,8R,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-methylbenzenesulfonamide |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO7S/c1-13-8-10-15(11-9-13)30(24,25)22-17-18(23)19-16(28-21(17)26-2)12-27-20(29-19)14-6-4-3-5-7-14/h3-11,16-23H,12H2,1-2H3/t16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | ZZTHXWIHTGZMLB-UFOPBENGSA-N |
| XLogP | 1.49 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |