C21H18F3NO4S — CID 11328053
(1R,2S,3R,5R,6R)-2-amino-3-[bis(4-fluorophenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11328053) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-3-[bis(4-fluorophenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-3-[bis(4-fluorophenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11328053 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-3-[bis(4-fluorophenyl)methylsulfanyl]-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)[C@H]2[C@@H](C[C@H]1SC(c1ccc(F)cc1)c1ccc(F)cc1)[C@]2(F)C(=O)O |
| InChI | InChI=1S/C21H18F3NO4S/c22-12-5-1-10(2-6-12)16(11-3-7-13(23)8-4-11)30-15-9-14-17(20(14,24)18(26)27)21(15,25)19(28)29/h1-8,14-17H,9,25H2,(H,26,27)(H,28,29)/t14-,15-,17+,20-,21+/m1/s1 |
| InChIKey | XEWYNRDIZZAPID-NROPHMHMSA-N |
| XLogP | 3.38 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |