About CID 11328195
CID 11328195 (PubChem CID 11328195) has the molecular formula C26H34O6
and a molecular weight of 442.55 g/mol.
Molecular Properties
| Compound Name | CID 11328195 |
| PubChem CID | 11328195 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1ccc(OCC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C26H34O6/c1-2-28-24(27)20-3-5-23(6-4-20)29-16-17-7-9-25(10-8-17)30-26(32-31-25)21-12-18-11-19(14-21)15-22(26)13-18/h3-6,17-19,21-22H,2,7-16H2,1H3 |
| InChIKey | BNWLKTPHFMLDMQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 11328195 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11328195?
The IUPAC name of CID 11328195 (CID 11328195) is not available.
What is the SMILES notation for CID 11328195?
The canonical SMILES for CID 11328195 is CCOC(=O)c1ccc(OCC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of CID 11328195?
The InChIKey is BNWLKTPHFMLDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34O6/c1-2-28-24(27)20-3-5-23(6-4-20)29-16-17-7-9-25(10-8-17)30-26(32-31-25)21-12-18-11-19(14-21)15-22(26)13-18/h3-6,17-19,21-22H,2,7-16H2,1H3.
What are the key properties of CID 11328195?
CID 11328195 has a molecular weight of 442.55 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11328195 is sourced from PubChem (CID 11328195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).