C24H46O5Si — CID 11328201
[(Z,2S,9S)-2,6-dimethyl-10-oxo-9-(2-trimethylsilylethoxymethoxy)undec-6-enyl] 2,2-dimethylpropanoate (PubChem CID 11328201) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is [(Z,2S,9S)-2,6-dimethyl-10-oxo-9-(2-trimethylsilylethoxymethoxy)undec-6-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z,2S,9S)-2,6-dimethyl-10-oxo-9-(2-trimethylsilylethoxymethoxy)undec-6-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11328201 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [(Z,2S,9S)-2,6-dimethyl-10-oxo-9-(2-trimethylsilylethoxymethoxy)undec-6-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)[C@H](C/C=C(/C)CCC[C@H](C)COC(=O)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H46O5Si/c1-19(11-10-12-20(2)17-28-23(26)24(4,5)6)13-14-22(21(3)25)29-18-27-15-16-30(7,8)9/h13,20,22H,10-12,14-18H2,1-9H3/b19-13-/t20-,22-/m0/s1 |
| InChIKey | IIZLSJPLXNVFPU-FQCMGDKLSA-N |
| XLogP | 6.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|