C13H17BrN2O — CID 113282155
N-(2-amino-2-cyclopropylethyl)-4-bromo-2-methylbenzamide (PubChem CID 113282155) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is N-(2-amino-2-cyclopropylethyl)-4-bromo-2-methylbenzamide.
| Compound Name | N-(2-amino-2-cyclopropylethyl)-4-bromo-2-methylbenzamide |
|---|---|
| PubChem CID | 113282155 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(2-amino-2-cyclopropylethyl)-4-bromo-2-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1C(=O)NCC(N)C1CC1 |
| InChI | InChI=1S/C13H17BrN2O/c1-8-6-10(14)4-5-11(8)13(17)16-7-12(15)9-2-3-9/h4-6,9,12H,2-3,7,15H2,1H3,(H,16,17) |
| InChIKey | WYSVLJXYKQCVFZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |