About dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate
dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate (PubChem CID 11328262) has the molecular formula C24H19N3O6
and a molecular weight of 445.43 g/mol. Its IUPAC name is dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate |
| PubChem CID | 11328262 |
| Molecular Formula | C24H19N3O6 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2c[nH]c3ccc(O)cc23)c1-c1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C24H19N3O6/c1-32-23(30)21-19(15-9-25-17-5-3-11(28)7-13(15)17)20(22(27-21)24(31)33-2)16-10-26-18-6-4-12(29)8-14(16)18/h3-10,25-29H,1-2H3 |
| InChIKey | GTHIVVRMSDWBAX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The IUPAC name of dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate (CID 11328262) is dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate.
What is the SMILES notation for dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The canonical SMILES for dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate is COC(=O)c1[nH]c(C(=O)OC)c(-c2c[nH]c3ccc(O)cc23)c1-c1c[nH]c2ccc(O)cc12.
What is the InChIKey of dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The InChIKey is GTHIVVRMSDWBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O6/c1-32-23(30)21-19(15-9-25-17-5-3-11(28)7-13(15)17)20(22(27-21)24(31)33-2)16-10-26-18-6-4-12(29)8-14(16)18/h3-10,25-29H,1-2H3.
What are the key properties of dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate has a molecular weight of 445.43 g/mol, XLogP of 4.30, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,4-bis(5-hydroxy-1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate is sourced from PubChem (CID 11328262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).