C16H32N2 — CID 113282880
1-(4,4-dimethylcycloheptyl)-N,4-dimethylpiperidin-4-amine (PubChem CID 113282880) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-(4,4-dimethylcycloheptyl)-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-(4,4-dimethylcycloheptyl)-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 113282880 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-(4,4-dimethylcycloheptyl)-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(C2CCCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C16H32N2/c1-15(2)8-5-6-14(7-9-15)18-12-10-16(3,17-4)11-13-18/h14,17H,5-13H2,1-4H3 |
| InChIKey | PTECOYBJNPFGSE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |