About 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine
2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine (PubChem CID 113283580) has the molecular formula C12H16F3N3
and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine |
| PubChem CID | 113283580 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine |
| SMILES | CC(CN)(Nc1cccc(C(F)(F)F)n1)C1CC1 |
| InChI | InChI=1S/C12H16F3N3/c1-11(7-16,8-5-6-8)18-10-4-2-3-9(17-10)12(13,14)15/h2-4,8H,5-7,16H2,1H3,(H,17,18) |
| InChIKey | DEJZXBVRVZLPGR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine?
The IUPAC name of 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine (CID 113283580) is 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine.
What is the SMILES notation for 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine?
The canonical SMILES for 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine is CC(CN)(Nc1cccc(C(F)(F)F)n1)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine?
The InChIKey is DEJZXBVRVZLPGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3/c1-11(7-16,8-5-6-8)18-10-4-2-3-9(17-10)12(13,14)15/h2-4,8H,5-7,16H2,1H3,(H,17,18).
What are the key properties of 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine?
2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine has a molecular weight of 259.27 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-N-[6-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine is sourced from PubChem (CID 113283580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).