C23H20N4O2S2 — CID 11328365
4-[2-[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]-4-methoxy-1,3-benzothiazol-7-yl]morpholine (PubChem CID 11328365) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[2-[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]-4-methoxy-1,3-benzothiazol-7-yl]morpholine.
| Compound Name | 4-[2-[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]-4-methoxy-1,3-benzothiazol-7-yl]morpholine |
|---|---|
| PubChem CID | 11328365 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 4-[2-[5-(1-benzothiophen-3-yl)-1H-imidazol-2-yl]-4-methoxy-1,3-benzothiazol-7-yl]morpholine |
| SMILES | COc1ccc(N2CCOCC2)c2sc(-c3ncc(-c4csc5ccccc45)[nH]3)nc12 |
| InChI | InChI=1S/C23H20N4O2S2/c1-28-18-7-6-17(27-8-10-29-11-9-27)21-20(18)26-23(31-21)22-24-12-16(25-22)15-13-30-19-5-3-2-4-14(15)19/h2-7,12-13H,8-11H2,1H3,(H,24,25) |
| InChIKey | QHUYXCIFGWHKFR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|