C13H22N4 — CID 113283802
1-cyclohexyl-N-(6-methylpyridazin-3-yl)ethane-1,2-diamine (PubChem CID 113283802) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1-cyclohexyl-N-(6-methylpyridazin-3-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-(6-methylpyridazin-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 113283802 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-cyclohexyl-N-(6-methylpyridazin-3-yl)ethane-1,2-diamine |
| SMILES | Cc1ccc(NC(CN)C2CCCCC2)nn1 |
| InChI | InChI=1S/C13H22N4/c1-10-7-8-13(17-16-10)15-12(9-14)11-5-3-2-4-6-11/h7-8,11-12H,2-6,9,14H2,1H3,(H,15,17) |
| InChIKey | IJIYHNUBXKDKJJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |