C26H46O4Si — CID 11328427
(1R,2R,3R,7R,8R,11S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,14-dimethyl-3-propan-2-ylspiro[15-oxatricyclo[6.6.1.02,7]pentadec-5-ene-10,2'-oxirane]-11-ol (PubChem CID 11328427) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is (1R,2R,3R,7R,8R,11S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,14-dimethyl-3-propan-2-ylspiro[15-oxatricyclo[6.6.1.02,7]pentadec-5-ene-10,2'-oxirane]-11-ol.
| Compound Name | (1R,2R,3R,7R,8R,11S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,14-dimethyl-3-propan-2-ylspiro[15-oxatricyclo[6.6.1.02,7]pentadec-5-ene-10,2'-oxirane]-11-ol |
|---|---|
| PubChem CID | 11328427 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (1R,2R,3R,7R,8R,11S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-6,14-dimethyl-3-propan-2-ylspiro[15-oxatricyclo[6.6.1.02,7]pentadec-5-ene-10,2'-oxirane]-11-ol |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1CC3(CO3)[C@@H](O)CC[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C26H46O4Si/c1-16(2)18-11-10-17(3)21-19-14-26(15-28-26)20(27)12-13-25(7,23(29-19)22(18)21)30-31(8,9)24(4,5)6/h10,16,18-23,27H,11-15H2,1-9H3/t18-,19-,20+,21-,22-,23-,25-,26?/m1/s1 |
| InChIKey | RFNZGTBQRZTMKG-XNFVGLBLSA-N |
| XLogP | 5.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|