C23H34ClNO4Si — CID 11328457
(3S)-3-(4-chlorophenyl)-4-nitro-1-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]butan-1-one (PubChem CID 11328457) has the molecular formula C23H34ClNO4Si and a molecular weight of 452.07 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-4-nitro-1-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]butan-1-one.
| Compound Name | (3S)-3-(4-chlorophenyl)-4-nitro-1-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]butan-1-one |
|---|---|
| PubChem CID | 11328457 |
| Molecular Formula | C23H34ClNO4Si |
| Molecular Weight | 452.07 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-4-nitro-1-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]butan-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O[Si](C)(C)C)(C(=O)C[C@H](C[N+](=O)[O-])c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C23H34ClNO4Si/c1-21(2)18-11-12-22(21,3)23(14-18,29-30(4,5)6)20(26)13-17(15-25(27)28)16-7-9-19(24)10-8-16/h7-10,17-18H,11-15H2,1-6H3/t17-,18-,22-,23+/m1/s1 |
| InChIKey | QPGGCFLWJMEKMN-GGILJOMBSA-N |
| XLogP | 6.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|