C14H24N2O — CID 113285685
N'-methyl-N'-[(4-propoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 113285685) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-methyl-N'-[(4-propoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-methyl-N'-[(4-propoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113285685 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N'-methyl-N'-[(4-propoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | CCCOc1ccc(CN(C)CCCN)cc1 |
| InChI | InChI=1S/C14H24N2O/c1-3-11-17-14-7-5-13(6-8-14)12-16(2)10-4-9-15/h5-8H,3-4,9-12,15H2,1-2H3 |
| InChIKey | GZOHVNBXTUUEOD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |