C23H18Cl2N2O4 — CID 11328580
methyl (2R,5R,6R,7R)-7-(2,6-dichlorophenyl)-2-(furan-3-yl)-4-oxo-5-phenyl-1,3-diazabicyclo[4.1.0]heptane-6-carboxylate (PubChem CID 11328580) has the molecular formula C23H18Cl2N2O4 and a molecular weight of 457.31 g/mol. Its IUPAC name is methyl (2R,5R,6R,7R)-7-(2,6-dichlorophenyl)-2-(furan-3-yl)-4-oxo-5-phenyl-1,3-diazabicyclo[4.1.0]heptane-6-carboxylate.
| Compound Name | methyl (2R,5R,6R,7R)-7-(2,6-dichlorophenyl)-2-(furan-3-yl)-4-oxo-5-phenyl-1,3-diazabicyclo[4.1.0]heptane-6-carboxylate |
|---|---|
| PubChem CID | 11328580 |
| Molecular Formula | C23H18Cl2N2O4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | methyl (2R,5R,6R,7R)-7-(2,6-dichlorophenyl)-2-(furan-3-yl)-4-oxo-5-phenyl-1,3-diazabicyclo[4.1.0]heptane-6-carboxylate |
| SMILES | COC(=O)[C@]12[C@@H](c3ccccc3)C(=O)N[C@@H](c3ccoc3)N1[C@@H]2c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O4/c1-30-22(29)23-18(13-6-3-2-4-7-13)21(28)26-20(14-10-11-31-12-14)27(23)19(23)17-15(24)8-5-9-16(17)25/h2-12,18-20H,1H3,(H,26,28)/t18-,19+,20+,23+,27?/m0/s1 |
| InChIKey | USJKQPRWQYCEHT-FGCBSEQHSA-N |
| XLogP | 4.47 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|