C13H15BrClNO2 — CID 113286146
3-bromo-5-chloro-N-[2-(oxolan-2-yl)ethyl]benzamide (PubChem CID 113286146) has the molecular formula C13H15BrClNO2 and a molecular weight of 332.63 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[2-(oxolan-2-yl)ethyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[2-(oxolan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113286146 |
| Molecular Formula | C13H15BrClNO2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 3-bromo-5-chloro-N-[2-(oxolan-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCC1CCCO1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C13H15BrClNO2/c14-10-6-9(7-11(15)8-10)13(17)16-4-3-12-2-1-5-18-12/h6-8,12H,1-5H2,(H,16,17) |
| InChIKey | MXSBLEKAOZJEJA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |