C27H27NO6 — CID 11328684
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-phenylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 11328684) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-phenylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-phenylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11328684 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[3-[(4-phenylphenyl)methyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3[nH]cc(Cc4ccc(-c5ccccc5)cc4)c23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H27NO6/c29-15-22-24(30)25(31)26(32)27(34-22)33-21-8-4-7-20-23(21)19(14-28-20)13-16-9-11-18(12-10-16)17-5-2-1-3-6-17/h1-12,14,22,24-32H,13,15H2/t22-,24-,25+,26-,27-/m1/s1 |
| InChIKey | WHIJALZOCQDRDN-UIKHAHSZSA-N |
| XLogP | 2.60 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |