5-propyl-1,2-oxazole-3-carboxylic acid

C7H9NO3 — CID 1132871

IUPAC5-propyl-1,2-oxazole-3-carboxylic acid
SMILESCCCc1cc(C(=O)O)no1
InChIInChI=1S/C7H9NO3/c1-2-3-5-4-6(7(9)10)8-11-5/h4H,2-3H2,1H3,(H,9,10)
InChIKeyZXWHSBZHRVKCGZ-UHFFFAOYSA-N
MW155.15 g/mol
LogP1.33
Rot. Bonds3

About 5-propyl-1,2-oxazole-3-carboxylic acid

5-propyl-1,2-oxazole-3-carboxylic acid (PubChem CID 1132871) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 5-propyl-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-propyl-1,2-oxazole-3-carboxylic acid
PubChem CID1132871
Molecular FormulaC7H9NO3
Molecular Weight155.15 g/mol
Exact Mass155.06
IUPAC Name5-propyl-1,2-oxazole-3-carboxylic acid
SMILESCCCc1cc(C(=O)O)no1
InChIInChI=1S/C7H9NO3/c1-2-3-5-4-6(7(9)10)8-11-5/h4H,2-3H2,1H3,(H,9,10)
InChIKeyZXWHSBZHRVKCGZ-UHFFFAOYSA-N
XLogP1.33
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.15
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-propyl-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-propyl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-propyl-1,2-oxazole-3-carboxylic acid (CID 1132871) is 5-propyl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-propyl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-propyl-1,2-oxazole-3-carboxylic acid is CCCc1cc(C(=O)O)no1.
What is the InChIKey of 5-propyl-1,2-oxazole-3-carboxylic acid?
The InChIKey is ZXWHSBZHRVKCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-2-3-5-4-6(7(9)10)8-11-5/h4H,2-3H2,1H3,(H,9,10).
What are the key properties of 5-propyl-1,2-oxazole-3-carboxylic acid?
5-propyl-1,2-oxazole-3-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 1132871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).