C16H25NS — CID 113287462
N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methylhexan-1-amine (PubChem CID 113287462) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methylhexan-1-amine.
| Compound Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methylhexan-1-amine |
|---|---|
| PubChem CID | 113287462 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methylhexan-1-amine |
| SMILES | CC(C)CCCCNCC1CSc2ccccc21 |
| InChI | InChI=1S/C16H25NS/c1-13(2)7-5-6-10-17-11-14-12-18-16-9-4-3-8-15(14)16/h3-4,8-9,13-14,17H,5-7,10-12H2,1-2H3 |
| InChIKey | ALUIIFHTQWZKCX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|