C14H20ClNO3S — CID 113287469
3-(5-methylhexylcarbamoyl)benzenesulfonyl chloride (PubChem CID 113287469) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 3-(5-methylhexylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-(5-methylhexylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 113287469 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(5-methylhexylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CC(C)CCCCNC(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-11(2)6-3-4-9-16-14(17)12-7-5-8-13(10-12)20(15,18)19/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H,16,17) |
| InChIKey | PJYXYEGJIFOPNE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|