About 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one
6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one (PubChem CID 113287789) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one |
| PubChem CID | 113287789 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one |
| SMILES | CC(C)CCCCn1ccc2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H27NO/c1-13(2)7-5-6-9-18-10-8-14-15(18)11-17(3,4)12-16(14)19/h8,10,13H,5-7,9,11-12H2,1-4H3 |
| InChIKey | CZORDSCRFWABSS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one?
The IUPAC name of 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one (CID 113287789) is 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one.
What is the SMILES notation for 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one?
The canonical SMILES for 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one is CC(C)CCCCn1ccc2c1CC(C)(C)CC2=O.
What is the InChIKey of 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one?
The InChIKey is CZORDSCRFWABSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-13(2)7-5-6-9-18-10-8-14-15(18)11-17(3,4)12-16(14)19/h8,10,13H,5-7,9,11-12H2,1-4H3.
What are the key properties of 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one?
6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one has a molecular weight of 261.41 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-(5-methylhexyl)-5,7-dihydroindol-4-one is sourced from PubChem (CID 113287789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).