C15H24N2 — CID 113288145
N',N'-dimethyl-N-(2-phenylprop-2-enyl)butane-1,4-diamine (PubChem CID 113288145) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-phenylprop-2-enyl)butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-(2-phenylprop-2-enyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 113288145 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N',N'-dimethyl-N-(2-phenylprop-2-enyl)butane-1,4-diamine |
| SMILES | C=C(CNCCCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H24N2/c1-14(15-9-5-4-6-10-15)13-16-11-7-8-12-17(2)3/h4-6,9-10,16H,1,7-8,11-13H2,2-3H3 |
| InChIKey | FWKNIRHBQKTSGE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|