C22H22ClN7OS — CID 11328827
N-(2-chloro-6-methylphenyl)-2-[[6-(3-imidazol-1-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 11328827) has the molecular formula C22H22ClN7OS and a molecular weight of 467.99 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-(3-imidazol-1-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-(3-imidazol-1-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 11328827 |
| Molecular Formula | C22H22ClN7OS |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-(3-imidazol-1-ylpropylamino)-2-pyridinyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1cnc(Nc2cccc(NCCCn3ccnc3)n2)s1 |
| InChI | InChI=1S/C22H22ClN7OS/c1-15-5-2-6-16(23)20(15)29-21(31)17-13-26-22(32-17)28-19-8-3-7-18(27-19)25-9-4-11-30-12-10-24-14-30/h2-3,5-8,10,12-14H,4,9,11H2,1H3,(H,29,31)(H2,25,26,27,28) |
| InChIKey | SJHDMDLDMVESHW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|