C12H19N3OS — CID 113289221
1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxy-N-methylpentan-2-amine (PubChem CID 113289221) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxy-N-methylpentan-2-amine.
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 113289221 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-5-methoxy-N-methylpentan-2-amine |
| SMILES | CNC(CCCOC)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C12H19N3OS/c1-13-10(4-3-6-16-2)8-11-9-15-5-7-17-12(15)14-11/h5,7,9-10,13H,3-4,6,8H2,1-2H3 |
| InChIKey | WLUQMVLZCNEAIH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|