C12H19NO3S — CID 113289806
N-[(1,1-dioxothiolan-3-yl)-(furan-3-yl)methyl]propan-1-amine (PubChem CID 113289806) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)-(furan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)-(furan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 113289806 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)-(furan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19NO3S/c1-2-5-13-12(10-3-6-16-8-10)11-4-7-17(14,15)9-11/h3,6,8,11-13H,2,4-5,7,9H2,1H3 |
| InChIKey | CKCRGAGEBWFZLE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |