About (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine
(3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine (PubChem CID 11329039) has the molecular formula C31H27NS2
and a molecular weight of 477.70 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine.
Molecular Properties
| Compound Name | (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine |
| PubChem CID | 11329039 |
| Molecular Formula | C31H27NS2 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine |
| SMILES | c1ccc(CN2C[C@H](Sc3ccc4ccccc4c3)[C@@H](Sc3ccc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C31H27NS2/c1-2-8-23(9-3-1)20-32-21-30(33-28-16-14-24-10-4-6-12-26(24)18-28)31(22-32)34-29-17-15-25-11-5-7-13-27(25)19-29/h1-19,30-31H,20-22H2/t30-,31-/m0/s1 |
| InChIKey | MTHHKWUJEKBMCE-CONSDPRKSA-N |
| XLogP | 8.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine?
The IUPAC name of (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine (CID 11329039) is (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine.
What is the SMILES notation for (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine?
The canonical SMILES for (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine is c1ccc(CN2C[C@H](Sc3ccc4ccccc4c3)[C@@H](Sc3ccc4ccccc4c3)C2)cc1.
What is the InChIKey of (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine?
The InChIKey is MTHHKWUJEKBMCE-CONSDPRKSA-N. The full InChI is InChI=1S/C31H27NS2/c1-2-8-23(9-3-1)20-32-21-30(33-28-16-14-24-10-4-6-12-26(24)18-28)31(22-32)34-29-17-15-25-11-5-7-13-27(25)19-29/h1-19,30-31H,20-22H2/t30-,31-/m0/s1.
What are the key properties of (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine?
(3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine has a molecular weight of 477.70 g/mol, XLogP of 8.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-benzyl-3,4-bis(naphthalen-2-ylsulfanyl)pyrrolidine is sourced from PubChem (CID 11329039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).