C27H48O5Si — CID 11329119
methyl (7R)-7-[(1S,2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]-7-hydroxyheptanoate (PubChem CID 11329119) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is methyl (7R)-7-[(1S,2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]-7-hydroxyheptanoate.
| Compound Name | methyl (7R)-7-[(1S,2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 11329119 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | methyl (7R)-7-[(1S,2S)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]-7-hydroxyheptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C=CC(=O)[C@@H]1[C@H](O)CCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O5Si/c1-8-9-11-14-22(32-33(6,7)27(2,3)4)19-17-21-18-20-24(29)26(21)23(28)15-12-10-13-16-25(30)31-5/h17-23,26,28H,8-16H2,1-7H3/b19-17+/t21-,22-,23+,26-/m0/s1 |
| InChIKey | OGZCRSPZIQAPJY-XOOOCGHCSA-N |
| XLogP | 6.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|