C20H39IO3Si — CID 11329154
tert-butyl-[(Z)-5-[(4R,5R)-5-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-enoxy]-dimethylsilane (PubChem CID 11329154) has the molecular formula C20H39IO3Si and a molecular weight of 482.52 g/mol. Its IUPAC name is tert-butyl-[(Z)-5-[(4R,5R)-5-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-5-[(4R,5R)-5-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11329154 |
| Molecular Formula | C20H39IO3Si |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | tert-butyl-[(Z)-5-[(4R,5R)-5-[(2R)-4-iodobutan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-enoxy]-dimethylsilane |
| SMILES | C[C@H](CCI)[C@H]1OC(C)(C)O[C@@H]1C/C=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H39IO3Si/c1-16(13-14-21)18-17(23-20(5,6)24-18)12-10-9-11-15-22-25(7,8)19(2,3)4/h9-10,16-18H,11-15H2,1-8H3/b10-9-/t16-,17-,18-/m1/s1 |
| InChIKey | AICMZIUYNVYYLJ-XHVFGDHJSA-N |
| XLogP | 6.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|