C12H15FN2O4 — CID 113293753
4-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-3-nitrobenzamide (PubChem CID 113293753) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-3-nitrobenzamide.
| Compound Name | 4-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 113293753 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-fluoro-N-(3-hydroxy-2,2-dimethylpropyl)-3-nitrobenzamide |
| SMILES | CC(C)(CO)CNC(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15FN2O4/c1-12(2,7-16)6-14-11(17)8-3-4-9(13)10(5-8)15(18)19/h3-5,16H,6-7H2,1-2H3,(H,14,17) |
| InChIKey | DFEUQYXSGDITEU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|