About [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol
[1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol (PubChem CID 113294060) has the molecular formula C13H23N3OS
and a molecular weight of 269.41 g/mol. Its IUPAC name is [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol |
| PubChem CID | 113294060 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol |
| SMILES | CC(C)(C)c1nsc(NCC2(CO)CCCC2)n1 |
| InChI | InChI=1S/C13H23N3OS/c1-12(2,3)10-15-11(18-16-10)14-8-13(9-17)6-4-5-7-13/h17H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | MJKBDKGLXBBMRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol?
The IUPAC name of [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol (CID 113294060) is [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol.
What is the SMILES notation for [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol?
The canonical SMILES for [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol is CC(C)(C)c1nsc(NCC2(CO)CCCC2)n1.
What is the InChIKey of [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol?
The InChIKey is MJKBDKGLXBBMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3OS/c1-12(2,3)10-15-11(18-16-10)14-8-13(9-17)6-4-5-7-13/h17H,4-9H2,1-3H3,(H,14,15,16).
What are the key properties of [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol?
[1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol has a molecular weight of 269.41 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclopentyl]methanol is sourced from PubChem (CID 113294060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).